C15H14Cl2FN3O3 — CID 153374508
N-[3,5-dichloro-2-fluoro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]acetamide (PubChem CID 153374508) has the molecular formula C15H14Cl2FN3O3 and a molecular weight of 374.20 g/mol. Its IUPAC name is N-[3,5-dichloro-2-fluoro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]acetamide.
| Compound Name | N-[3,5-dichloro-2-fluoro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]acetamide |
|---|---|
| PubChem CID | 153374508 |
| Molecular Formula | C15H14Cl2FN3O3 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-[3,5-dichloro-2-fluoro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Cl)c(Oc2cc(C(C)C)c(=O)[nH]n2)c(Cl)c1F |
| InChI | InChI=1S/C15H14Cl2FN3O3/c1-6(2)8-4-11(20-21-15(8)23)24-14-9(16)5-10(19-7(3)22)13(18)12(14)17/h4-6H,1-3H3,(H,19,22)(H,21,23) |
| InChIKey | DJVYGQOKQSMTMO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|