C17H14Cl2NO5P — CID 11998226
[3,5-dichloro-4-(4-hydroxynaphthalen-1-yl)oxyanilino]methylphosphonic acid (PubChem CID 11998226) has the molecular formula C17H14Cl2NO5P and a molecular weight of 414.18 g/mol. Its IUPAC name is [3,5-dichloro-4-(4-hydroxynaphthalen-1-yl)oxyanilino]methylphosphonic acid.
| Compound Name | [3,5-dichloro-4-(4-hydroxynaphthalen-1-yl)oxyanilino]methylphosphonic acid |
|---|---|
| PubChem CID | 11998226 |
| Molecular Formula | C17H14Cl2NO5P |
| Molecular Weight | 414.18 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | [3,5-dichloro-4-(4-hydroxynaphthalen-1-yl)oxyanilino]methylphosphonic acid |
| SMILES | O=P(O)(O)CNc1cc(Cl)c(Oc2ccc(O)c3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2NO5P/c18-13-7-10(20-9-26(22,23)24)8-14(19)17(13)25-16-6-5-15(21)11-3-1-2-4-12(11)16/h1-8,20-21H,9H2,(H2,22,23,24) |
| InChIKey | IHHZMPLMZDYYCG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.18 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|