C25H19Cl2NO3 — CID 23792360
N-[3-chloro-4-(4-chloronaphthalen-1-yl)oxyphenyl]-2-(2-methoxyphenyl)acetamide (PubChem CID 23792360) has the molecular formula C25H19Cl2NO3 and a molecular weight of 452.34 g/mol. Its IUPAC name is N-[3-chloro-4-(4-chloronaphthalen-1-yl)oxyphenyl]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[3-chloro-4-(4-chloronaphthalen-1-yl)oxyphenyl]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23792360 |
| Molecular Formula | C25H19Cl2NO3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-[3-chloro-4-(4-chloronaphthalen-1-yl)oxyphenyl]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)Nc1ccc(Oc2ccc(Cl)c3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C25H19Cl2NO3/c1-30-22-9-5-2-6-16(22)14-25(29)28-17-10-12-24(21(27)15-17)31-23-13-11-20(26)18-7-3-4-8-19(18)23/h2-13,15H,14H2,1H3,(H,28,29) |
| InChIKey | WILIKHANTXRGET-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |