C18H22Br2NO5P — CID 129060871
[3,5-dibromo-4-(4-hydroxy-2-methyl-3-propan-2-ylphenoxy)anilino]methyl-methoxyphosphinic acid (PubChem CID 129060871) has the molecular formula C18H22Br2NO5P and a molecular weight of 523.16 g/mol. Its IUPAC name is [3,5-dibromo-4-(4-hydroxy-2-methyl-3-propan-2-ylphenoxy)anilino]methyl-methoxyphosphinic acid.
| Compound Name | [3,5-dibromo-4-(4-hydroxy-2-methyl-3-propan-2-ylphenoxy)anilino]methyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 129060871 |
| Molecular Formula | C18H22Br2NO5P |
| Molecular Weight | 523.16 g/mol |
| Exact Mass | 520.96 |
| IUPAC Name | [3,5-dibromo-4-(4-hydroxy-2-methyl-3-propan-2-ylphenoxy)anilino]methyl-methoxyphosphinic acid |
| SMILES | COP(=O)(O)CNc1cc(Br)c(Oc2ccc(O)c(C(C)C)c2C)c(Br)c1 |
| InChI | InChI=1S/C18H22Br2NO5P/c1-10(2)17-11(3)16(6-5-15(17)22)26-18-13(19)7-12(8-14(18)20)21-9-27(23,24)25-4/h5-8,10,21-22H,9H2,1-4H3,(H,23,24) |
| InChIKey | GVKCMFOKUKRPAU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.16 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|