C19H26NO4P — CID 15942413
[4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylanilino]methylphosphonic acid (PubChem CID 15942413) has the molecular formula C19H26NO4P and a molecular weight of 363.39 g/mol. Its IUPAC name is [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylanilino]methylphosphonic acid.
| Compound Name | [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylanilino]methylphosphonic acid |
|---|---|
| PubChem CID | 15942413 |
| Molecular Formula | C19H26NO4P |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylanilino]methylphosphonic acid |
| SMILES | Cc1cc(NCP(=O)(O)O)cc(C)c1Cc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C19H26NO4P/c1-12(2)17-9-15(5-6-19(17)21)10-18-13(3)7-16(8-14(18)4)20-11-25(22,23)24/h5-9,12,20-21H,10-11H2,1-4H3,(H2,22,23,24) |
| InChIKey | JSSKTVXZGDRQIS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|