C23H32FO3P — CID 174560749
4-[[4-[fluoro-[methyl(propoxy)phosphoryl]methyl]-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol (PubChem CID 174560749) has the molecular formula C23H32FO3P and a molecular weight of 406.48 g/mol. Its IUPAC name is 4-[[4-[fluoro-[methyl(propoxy)phosphoryl]methyl]-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol.
| Compound Name | 4-[[4-[fluoro-[methyl(propoxy)phosphoryl]methyl]-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 174560749 |
| Molecular Formula | C23H32FO3P |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-[[4-[fluoro-[methyl(propoxy)phosphoryl]methyl]-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol |
| SMILES | CCCOP(C)(=O)C(F)c1cc(C)c(Cc2ccc(O)c(C(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C23H32FO3P/c1-7-10-27-28(6,26)23(24)19-11-16(4)21(17(5)12-19)14-18-8-9-22(25)20(13-18)15(2)3/h8-9,11-13,15,23,25H,7,10,14H2,1-6H3 |
| InChIKey | SPPMTYFQDMIGGB-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|