C33H52N3O5P — CID 68957710
[4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]methyl-N,N-bis[2-methylpropanoyl(propan-2-yl)amino]phosphonamidic acid (PubChem CID 68957710) has the molecular formula C33H52N3O5P and a molecular weight of 601.77 g/mol. Its IUPAC name is [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]methyl-N,N-bis[2-methylpropanoyl(propan-2-yl)amino]phosphonamidic acid.
| Compound Name | [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]methyl-N,N-bis[2-methylpropanoyl(propan-2-yl)amino]phosphonamidic acid |
|---|---|
| PubChem CID | 68957710 |
| Molecular Formula | C33H52N3O5P |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]methyl-N,N-bis[2-methylpropanoyl(propan-2-yl)amino]phosphonamidic acid |
| SMILES | Cc1cc(CP(=O)(O)N(N(C(=O)C(C)C)C(C)C)N(C(=O)C(C)C)C(C)C)cc(C)c1Cc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C33H52N3O5P/c1-20(2)29-17-27(13-14-31(29)37)18-30-25(11)15-28(16-26(30)12)19-42(40,41)36(34(23(7)8)32(38)21(3)4)35(24(9)10)33(39)22(5)6/h13-17,20-24,37H,18-19H2,1-12H3,(H,40,41) |
| InChIKey | GJMBEIVOPBIOAB-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|