3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid

C15H10Br2O6 — CID 14644844

IUPAC3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid
SMILESCc1cc(Br)c(Oc2ccc(O)c(C(=O)O)c2C(=O)O)c(Br)c1
InChIInChI=1S/C15H10Br2O6/c1-6-4-7(16)13(8(17)5-6)23-10-3-2-9(18)11(14(19)20)12(10)15(21)22/h2-5,18H,1H3,(H,19,20)(H,21,22)
InChIKeyIJBCYMGEFYILBU-UHFFFAOYSA-N
MW446.05 g/mol
LogP4.41
Rot. Bonds4

About 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid

3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid (PubChem CID 14644844) has the molecular formula C15H10Br2O6 and a molecular weight of 446.05 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid.

Molecular Properties

Compound Name3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid
PubChem CID14644844
Molecular FormulaC15H10Br2O6
Molecular Weight446.05 g/mol
Exact Mass443.88
IUPAC Name3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid
SMILESCc1cc(Br)c(Oc2ccc(O)c(C(=O)O)c2C(=O)O)c(Br)c1
InChIInChI=1S/C15H10Br2O6/c1-6-4-7(16)13(8(17)5-6)23-10-3-2-9(18)11(14(19)20)12(10)15(21)22/h2-5,18H,1H3,(H,19,20)(H,21,22)
InChIKeyIJBCYMGEFYILBU-UHFFFAOYSA-N
XLogP4.41
TPSA104.06 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500446.05
LogP ≤ 54.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid?
The IUPAC name of 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid (CID 14644844) is 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid.
What is the SMILES notation for 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid?
The canonical SMILES for 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid is Cc1cc(Br)c(Oc2ccc(O)c(C(=O)O)c2C(=O)O)c(Br)c1.
What is the InChIKey of 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid?
The InChIKey is IJBCYMGEFYILBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Br2O6/c1-6-4-7(16)13(8(17)5-6)23-10-3-2-9(18)11(14(19)20)12(10)15(21)22/h2-5,18H,1H3,(H,19,20)(H,21,22).
What are the key properties of 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid?
3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid has a molecular weight of 446.05 g/mol, XLogP of 4.41, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid is sourced from PubChem (CID 14644844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).