C15H10Br2O6 — CID 14644844
3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid (PubChem CID 14644844) has the molecular formula C15H10Br2O6 and a molecular weight of 446.05 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid.
| Compound Name | 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid |
|---|---|
| PubChem CID | 14644844 |
| Molecular Formula | C15H10Br2O6 |
| Molecular Weight | 446.05 g/mol |
| Exact Mass | 443.88 |
| IUPAC Name | 3-(2,6-dibromo-4-methylphenoxy)-6-hydroxyphthalic acid |
| SMILES | Cc1cc(Br)c(Oc2ccc(O)c(C(=O)O)c2C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C15H10Br2O6/c1-6-4-7(16)13(8(17)5-6)23-10-3-2-9(18)11(14(19)20)12(10)15(21)22/h2-5,18H,1H3,(H,19,20)(H,21,22) |
| InChIKey | IJBCYMGEFYILBU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.05 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |