C15H16N2O6 — CID 135187783
3,6-dihydroxyphthalic acid;5-methylbenzene-1,3-diamine (PubChem CID 135187783) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is 3,6-dihydroxyphthalic acid;5-methylbenzene-1,3-diamine.
| Compound Name | 3,6-dihydroxyphthalic acid;5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 135187783 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3,6-dihydroxyphthalic acid;5-methylbenzene-1,3-diamine |
| SMILES | Cc1cc(N)cc(N)c1.O=C(O)c1c(O)ccc(O)c1C(=O)O |
| InChI | InChI=1S/C8H6O6.C7H10N2/c9-3-1-2-4(10)6(8(13)14)5(3)7(11)12;1-5-2-6(8)4-7(9)3-5/h1-2,9-10H,(H,11,12)(H,13,14);2-4H,8-9H2,1H3 |
| InChIKey | SRUZPFGRAXNEKK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|