2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid

C15H12O6 — CID 74015882

IUPAC2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid
SMILESCc1cc(O)c(C(=O)c2c(O)cccc2C(=O)O)c(O)c1
InChIInChI=1S/C15H12O6/c1-7-5-10(17)13(11(18)6-7)14(19)12-8(15(20)21)3-2-4-9(12)16/h2-6,16-18H,1H3,(H,20,21)
InChIKeyKNXAGUANLPVZSV-UHFFFAOYSA-N
MW288.25 g/mol
LogP2.04
Rot. Bonds3

About 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid

2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid (PubChem CID 74015882) has the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. Its IUPAC name is 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid.

Molecular Properties

Compound Name2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid
PubChem CID74015882
Molecular FormulaC15H12O6
Molecular Weight288.25 g/mol
Exact Mass288.06
IUPAC Name2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid
SMILESCc1cc(O)c(C(=O)c2c(O)cccc2C(=O)O)c(O)c1
InChIInChI=1S/C15H12O6/c1-7-5-10(17)13(11(18)6-7)14(19)12-8(15(20)21)3-2-4-9(12)16/h2-6,16-18H,1H3,(H,20,21)
InChIKeyKNXAGUANLPVZSV-UHFFFAOYSA-N
XLogP2.04
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.25
LogP ≤ 52.04
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid?
The IUPAC name of 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid (CID 74015882) is 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid.
What is the SMILES notation for 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid?
The canonical SMILES for 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid is Cc1cc(O)c(C(=O)c2c(O)cccc2C(=O)O)c(O)c1.
What is the InChIKey of 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid?
The InChIKey is KNXAGUANLPVZSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O6/c1-7-5-10(17)13(11(18)6-7)14(19)12-8(15(20)21)3-2-4-9(12)16/h2-6,16-18H,1H3,(H,20,21).
What are the key properties of 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid?
2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid has a molecular weight of 288.25 g/mol, XLogP of 2.04, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoic acid is sourced from PubChem (CID 74015882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).