C26H26Cl4O10 — CID 10651728
2,6-bis[2,6-dichloro-4-(2-methoxyethoxymethoxy)phenoxy]benzene-1,4-diol (PubChem CID 10651728) has the molecular formula C26H26Cl4O10 and a molecular weight of 640.30 g/mol. Its IUPAC name is 2,6-bis[2,6-dichloro-4-(2-methoxyethoxymethoxy)phenoxy]benzene-1,4-diol.
| Compound Name | 2,6-bis[2,6-dichloro-4-(2-methoxyethoxymethoxy)phenoxy]benzene-1,4-diol |
|---|---|
| PubChem CID | 10651728 |
| Molecular Formula | C26H26Cl4O10 |
| Molecular Weight | 640.30 g/mol |
| Exact Mass | 638.03 |
| IUPAC Name | 2,6-bis[2,6-dichloro-4-(2-methoxyethoxymethoxy)phenoxy]benzene-1,4-diol |
| SMILES | COCCOCOc1cc(Cl)c(Oc2cc(O)cc(Oc3c(Cl)cc(OCOCCOC)cc3Cl)c2O)c(Cl)c1 |
| InChI | InChI=1S/C26H26Cl4O10/c1-33-3-5-35-13-37-16-9-18(27)25(19(28)10-16)39-22-7-15(31)8-23(24(22)32)40-26-20(29)11-17(12-21(26)30)38-14-36-6-4-34-2/h7-12,31-32H,3-6,13-14H2,1-2H3 |
| InChIKey | XRLFBWKQSYQYOH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.30 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|