C11H12Cl2O4 — CID 19833378
2,3-dichloro-5-(2-methoxyethoxymethoxy)benzaldehyde (PubChem CID 19833378) has the molecular formula C11H12Cl2O4 and a molecular weight of 279.12 g/mol. Its IUPAC name is 2,3-dichloro-5-(2-methoxyethoxymethoxy)benzaldehyde.
| Compound Name | 2,3-dichloro-5-(2-methoxyethoxymethoxy)benzaldehyde |
|---|---|
| PubChem CID | 19833378 |
| Molecular Formula | C11H12Cl2O4 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 2,3-dichloro-5-(2-methoxyethoxymethoxy)benzaldehyde |
| SMILES | COCCOCOc1cc(Cl)c(Cl)c(C=O)c1 |
| InChI | InChI=1S/C11H12Cl2O4/c1-15-2-3-16-7-17-9-4-8(6-14)11(13)10(12)5-9/h4-6H,2-3,7H2,1H3 |
| InChIKey | BRCHZDWGMUCXAP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|