C22H21ClN2O4 — CID 173185898
4-[3-chloro-5-(2-methoxyethoxymethoxy)-2-pyridinyl]-N-phenylbenzamide (PubChem CID 173185898) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is 4-[3-chloro-5-(2-methoxyethoxymethoxy)-2-pyridinyl]-N-phenylbenzamide.
| Compound Name | 4-[3-chloro-5-(2-methoxyethoxymethoxy)-2-pyridinyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 173185898 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-[3-chloro-5-(2-methoxyethoxymethoxy)-2-pyridinyl]-N-phenylbenzamide |
| SMILES | COCCOCOc1cnc(-c2ccc(C(=O)Nc3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C22H21ClN2O4/c1-27-11-12-28-15-29-19-13-20(23)21(24-14-19)16-7-9-17(10-8-16)22(26)25-18-5-3-2-4-6-18/h2-10,13-14H,11-12,15H2,1H3,(H,25,26) |
| InChIKey | BEFKZUWACAXNGC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|