C20H16ClN3O4 — CID 68713665
[2-[[4-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamic acid (PubChem CID 68713665) has the molecular formula C20H16ClN3O4 and a molecular weight of 397.82 g/mol. Its IUPAC name is [2-[[4-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamic acid.
| Compound Name | [2-[[4-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 68713665 |
| Molecular Formula | C20H16ClN3O4 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [2-[[4-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccccc1NC(=O)c1ccc(-c2ncc(CO)cc2Cl)cc1 |
| InChI | InChI=1S/C20H16ClN3O4/c21-15-9-12(11-25)10-22-18(15)13-5-7-14(8-6-13)19(26)23-16-3-1-2-4-17(16)24-20(27)28/h1-10,24-25H,11H2,(H,23,26)(H,27,28) |
| InChIKey | DHIHFOGODFJPJV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |