C15H22O4 — CID 155578596
2-[2-(2-methoxyethoxy)ethoxy]-3,4,5-trimethylbenzaldehyde (PubChem CID 155578596) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]-3,4,5-trimethylbenzaldehyde.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]-3,4,5-trimethylbenzaldehyde |
|---|---|
| PubChem CID | 155578596 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]-3,4,5-trimethylbenzaldehyde |
| SMILES | COCCOCCOc1c(C=O)cc(C)c(C)c1C |
| InChI | InChI=1S/C15H22O4/c1-11-9-14(10-16)15(13(3)12(11)2)19-8-7-18-6-5-17-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | RXGFYCUKDXJNQT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|