C18H24NO6P — CID 68534294
[4-[[3-amino-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid (PubChem CID 68534294) has the molecular formula C18H24NO6P and a molecular weight of 381.37 g/mol. Its IUPAC name is [4-[[3-amino-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid.
| Compound Name | [4-[[3-amino-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 68534294 |
| Molecular Formula | C18H24NO6P |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [4-[[3-amino-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
| SMILES | COCOc1ccc(Cc2c(C)cc(OCP(=O)(O)O)cc2C)cc1N |
| InChI | InChI=1S/C18H24NO6P/c1-12-6-15(25-11-26(20,21)22)7-13(2)16(12)8-14-4-5-18(17(19)9-14)24-10-23-3/h4-7,9H,8,10-11,19H2,1-3H3,(H2,20,21,22) |
| InChIKey | LLFQUVOZDMDMKX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|