C24H25F2O6P — CID 143340260
[4-[[3-[3-(1,1-difluoroethyl)phenoxy]-4-hydroxyphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid (PubChem CID 143340260) has the molecular formula C24H25F2O6P and a molecular weight of 478.43 g/mol. Its IUPAC name is [4-[[3-[3-(1,1-difluoroethyl)phenoxy]-4-hydroxyphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid.
| Compound Name | [4-[[3-[3-(1,1-difluoroethyl)phenoxy]-4-hydroxyphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 143340260 |
| Molecular Formula | C24H25F2O6P |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [4-[[3-[3-(1,1-difluoroethyl)phenoxy]-4-hydroxyphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
| SMILES | Cc1cc(OCP(=O)(O)O)cc(C)c1Cc1ccc(O)c(Oc2cccc(C(C)(F)F)c2)c1 |
| InChI | InChI=1S/C24H25F2O6P/c1-15-9-20(31-14-33(28,29)30)10-16(2)21(15)11-17-7-8-22(27)23(12-17)32-19-6-4-5-18(13-19)24(3,25)26/h4-10,12-13,27H,11,14H2,1-3H3,(H2,28,29,30) |
| InChIKey | SVYZVCXRGNVNJF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|