2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid

C17H18O4 — CID 162661242

IUPAC2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid
SMILESCc1cc(OCC(=O)O)cc(C)c1Cc1ccc(O)cc1
InChIInChI=1S/C17H18O4/c1-11-7-15(21-10-17(19)20)8-12(2)16(11)9-13-3-5-14(18)6-4-13/h3-8,18H,9-10H2,1-2H3,(H,19,20)
InChIKeyIZDOHLGFNXPMME-UHFFFAOYSA-N
MW286.33 g/mol
LogP3.06
Rot. Bonds5

About 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid

2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid (PubChem CID 162661242) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid.

Molecular Properties

Compound Name2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid
PubChem CID162661242
Molecular FormulaC17H18O4
Molecular Weight286.33 g/mol
Exact Mass286.12
IUPAC Name2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid
SMILESCc1cc(OCC(=O)O)cc(C)c1Cc1ccc(O)cc1
InChIInChI=1S/C17H18O4/c1-11-7-15(21-10-17(19)20)8-12(2)16(11)9-13-3-5-14(18)6-4-13/h3-8,18H,9-10H2,1-2H3,(H,19,20)
InChIKeyIZDOHLGFNXPMME-UHFFFAOYSA-N
XLogP3.06
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.33
LogP ≤ 53.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid?
The IUPAC name of 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid (CID 162661242) is 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid.
What is the SMILES notation for 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid?
The canonical SMILES for 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid is Cc1cc(OCC(=O)O)cc(C)c1Cc1ccc(O)cc1.
What is the InChIKey of 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid?
The InChIKey is IZDOHLGFNXPMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4/c1-11-7-15(21-10-17(19)20)8-12(2)16(11)9-13-3-5-14(18)6-4-13/h3-8,18H,9-10H2,1-2H3,(H,19,20).
What are the key properties of 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid?
2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid has a molecular weight of 286.33 g/mol, XLogP of 3.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]acetic acid is sourced from PubChem (CID 162661242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).