C17H21NO2 — CID 162653832
4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]phenol (PubChem CID 162653832) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]phenol.
| Compound Name | 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]phenol |
|---|---|
| PubChem CID | 162653832 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]phenol |
| SMILES | Cc1cc(OCCN)cc(C)c1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C17H21NO2/c1-12-9-16(20-8-7-18)10-13(2)17(12)11-14-3-5-15(19)6-4-14/h3-6,9-10,19H,7-8,11,18H2,1-2H3 |
| InChIKey | HFGJJSCNOPKUGS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |