C19H25O3P — CID 68957718
4-[[4-[[ethoxy(methyl)phosphoryl]methyl]-2,6-dimethylphenyl]methyl]phenol (PubChem CID 68957718) has the molecular formula C19H25O3P and a molecular weight of 332.38 g/mol. Its IUPAC name is 4-[[4-[[ethoxy(methyl)phosphoryl]methyl]-2,6-dimethylphenyl]methyl]phenol.
| Compound Name | 4-[[4-[[ethoxy(methyl)phosphoryl]methyl]-2,6-dimethylphenyl]methyl]phenol |
|---|---|
| PubChem CID | 68957718 |
| Molecular Formula | C19H25O3P |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-[[4-[[ethoxy(methyl)phosphoryl]methyl]-2,6-dimethylphenyl]methyl]phenol |
| SMILES | CCOP(C)(=O)Cc1cc(C)c(Cc2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C19H25O3P/c1-5-22-23(4,21)13-17-10-14(2)19(15(3)11-17)12-16-6-8-18(20)9-7-16/h6-11,20H,5,12-13H2,1-4H3 |
| InChIKey | GZCIHOSCGYTSHE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|