C25H26BrFO2 — CID 68955167
5-(bromomethyl)-2-[[3-[(4-fluorophenyl)methyl]-4-(methoxymethoxy)phenyl]methyl]-1,3-dimethylbenzene (PubChem CID 68955167) has the molecular formula C25H26BrFO2 and a molecular weight of 457.38 g/mol. Its IUPAC name is 5-(bromomethyl)-2-[[3-[(4-fluorophenyl)methyl]-4-(methoxymethoxy)phenyl]methyl]-1,3-dimethylbenzene.
| Compound Name | 5-(bromomethyl)-2-[[3-[(4-fluorophenyl)methyl]-4-(methoxymethoxy)phenyl]methyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 68955167 |
| Molecular Formula | C25H26BrFO2 |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 5-(bromomethyl)-2-[[3-[(4-fluorophenyl)methyl]-4-(methoxymethoxy)phenyl]methyl]-1,3-dimethylbenzene |
| SMILES | COCOc1ccc(Cc2c(C)cc(CBr)cc2C)cc1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H26BrFO2/c1-17-10-21(15-26)11-18(2)24(17)14-20-6-9-25(29-16-28-3)22(13-20)12-19-4-7-23(27)8-5-19/h4-11,13H,12,14-16H2,1-3H3 |
| InChIKey | AFSDMLWKPPRMPH-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|