C22H20ClFO3 — CID 175256749
2-chloro-4-[[3-[(4-fluorophenyl)methyl]-4-(methoxymethoxy)phenyl]methyl]phenol (PubChem CID 175256749) has the molecular formula C22H20ClFO3 and a molecular weight of 386.85 g/mol. Its IUPAC name is 2-chloro-4-[[3-[(4-fluorophenyl)methyl]-4-(methoxymethoxy)phenyl]methyl]phenol.
| Compound Name | 2-chloro-4-[[3-[(4-fluorophenyl)methyl]-4-(methoxymethoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 175256749 |
| Molecular Formula | C22H20ClFO3 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-chloro-4-[[3-[(4-fluorophenyl)methyl]-4-(methoxymethoxy)phenyl]methyl]phenol |
| SMILES | COCOc1ccc(Cc2ccc(O)c(Cl)c2)cc1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H20ClFO3/c1-26-14-27-22-9-5-16(10-17-4-8-21(25)20(23)13-17)12-18(22)11-15-2-6-19(24)7-3-15/h2-9,12-13,25H,10-11,14H2,1H3 |
| InChIKey | UKURAWADROIIAJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|