C18H22O3S — CID 140535933
4-[[4-(methoxymethoxy)-3-propan-2-ylsulfanylphenyl]methyl]phenol (PubChem CID 140535933) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-[[4-(methoxymethoxy)-3-propan-2-ylsulfanylphenyl]methyl]phenol.
| Compound Name | 4-[[4-(methoxymethoxy)-3-propan-2-ylsulfanylphenyl]methyl]phenol |
|---|---|
| PubChem CID | 140535933 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 4-[[4-(methoxymethoxy)-3-propan-2-ylsulfanylphenyl]methyl]phenol |
| SMILES | COCOc1ccc(Cc2ccc(O)cc2)cc1SC(C)C |
| InChI | InChI=1S/C18H22O3S/c1-13(2)22-18-11-15(6-9-17(18)21-12-20-3)10-14-4-7-16(19)8-5-14/h4-9,11,13,19H,10,12H2,1-3H3 |
| InChIKey | XJENJTMSQKJHMK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|