C15H15F — CID 158519534
2-[(4-fluorophenyl)methyl]-1,3-dimethylbenzene (PubChem CID 158519534) has the molecular formula C15H15F and a molecular weight of 214.28 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-1,3-dimethylbenzene.
| Compound Name | 2-[(4-fluorophenyl)methyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 158519534 |
| Molecular Formula | C15H15F |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H15F/c1-11-4-3-5-12(2)15(11)10-13-6-8-14(16)9-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | HMAWEQQAZDNSRL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |