C26H29NO4 — CID 66646326
5-[(4-hydroxy-2,6-dimethylphenyl)methyl]-2-(methoxymethoxy)-N-(2-phenylethyl)benzamide (PubChem CID 66646326) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 5-[(4-hydroxy-2,6-dimethylphenyl)methyl]-2-(methoxymethoxy)-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(4-hydroxy-2,6-dimethylphenyl)methyl]-2-(methoxymethoxy)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 66646326 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 5-[(4-hydroxy-2,6-dimethylphenyl)methyl]-2-(methoxymethoxy)-N-(2-phenylethyl)benzamide |
| SMILES | COCOc1ccc(Cc2c(C)cc(O)cc2C)cc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C26H29NO4/c1-18-13-22(28)14-19(2)23(18)15-21-9-10-25(31-17-30-3)24(16-21)26(29)27-12-11-20-7-5-4-6-8-20/h4-10,13-14,16,28H,11-12,15,17H2,1-3H3,(H,27,29) |
| InChIKey | RVFAYEWPXKKLAS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|