C36H42O7PS2+ — CID 66642777
bis[[4-(4-hydroxy-3-propan-2-ylphenyl)sulfanyl-3,5-dimethylphenoxy]methoxy]-oxophosphanium (PubChem CID 66642777) has the molecular formula C36H42O7PS2+ and a molecular weight of 681.83 g/mol. Its IUPAC name is bis[[4-(4-hydroxy-3-propan-2-ylphenyl)sulfanyl-3,5-dimethylphenoxy]methoxy]-oxophosphanium.
| Compound Name | bis[[4-(4-hydroxy-3-propan-2-ylphenyl)sulfanyl-3,5-dimethylphenoxy]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 66642777 |
| Molecular Formula | C36H42O7PS2+ |
| Molecular Weight | 681.83 g/mol |
| Exact Mass | 681.21 |
| IUPAC Name | bis[[4-(4-hydroxy-3-propan-2-ylphenyl)sulfanyl-3,5-dimethylphenoxy]methoxy]-oxophosphanium |
| SMILES | Cc1cc(OCO[P+](=O)OCOc2cc(C)c(Sc3ccc(O)c(C(C)C)c3)c(C)c2)cc(C)c1Sc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C36H41O7PS2/c1-21(2)31-17-29(9-11-33(31)37)45-35-23(5)13-27(14-24(35)6)40-19-42-44(39)43-20-41-28-15-25(7)36(26(8)16-28)46-30-10-12-34(38)32(18-30)22(3)4/h9-18,21-22H,19-20H2,1-8H3,(H-,37,38)/p+1 |
| InChIKey | DHDBGBWYTBBJIG-UHFFFAOYSA-O |
| XLogP | 10.94 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.83 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|