C22H36NO4P — CID 143340063
ethane;[4-(4-hydroxy-3-propan-2-ylanilino)-3,5-dimethylphenoxy]methylphosphonous acid (PubChem CID 143340063) has the molecular formula C22H36NO4P and a molecular weight of 409.51 g/mol. Its IUPAC name is ethane;[4-(4-hydroxy-3-propan-2-ylanilino)-3,5-dimethylphenoxy]methylphosphonous acid.
| Compound Name | ethane;[4-(4-hydroxy-3-propan-2-ylanilino)-3,5-dimethylphenoxy]methylphosphonous acid |
|---|---|
| PubChem CID | 143340063 |
| Molecular Formula | C22H36NO4P |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | ethane;[4-(4-hydroxy-3-propan-2-ylanilino)-3,5-dimethylphenoxy]methylphosphonous acid |
| SMILES | CC.CC.Cc1cc(OCP(O)O)cc(C)c1Nc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C18H24NO4P.2C2H6/c1-11(2)16-9-14(5-6-17(16)20)19-18-12(3)7-15(8-13(18)4)23-10-24(21)22;2*1-2/h5-9,11,19-22H,10H2,1-4H3;2*1-2H3 |
| InChIKey | CVXOQOGURXEOGD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|