C21H29O4P — CID 86620240
2-(2-diethoxyphosphorylethyl)-4-[(4-ethylphenyl)methyl]phenol (PubChem CID 86620240) has the molecular formula C21H29O4P and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-(2-diethoxyphosphorylethyl)-4-[(4-ethylphenyl)methyl]phenol.
| Compound Name | 2-(2-diethoxyphosphorylethyl)-4-[(4-ethylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 86620240 |
| Molecular Formula | C21H29O4P |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-(2-diethoxyphosphorylethyl)-4-[(4-ethylphenyl)methyl]phenol |
| SMILES | CCOP(=O)(CCc1cc(Cc2ccc(CC)cc2)ccc1O)OCC |
| InChI | InChI=1S/C21H29O4P/c1-4-17-7-9-18(10-8-17)15-19-11-12-21(22)20(16-19)13-14-26(23,24-5-2)25-6-3/h7-12,16,22H,4-6,13-15H2,1-3H3 |
| InChIKey | NSSFWZUHSKWEQH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|