C21H30N2O2 — CID 163931349
2-[[ethyl(methyl)amino]methyl]-4-[[3-[[ethyl(methyl)amino]methyl]-4-hydroxyphenyl]methyl]phenol (PubChem CID 163931349) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-[[ethyl(methyl)amino]methyl]-4-[[3-[[ethyl(methyl)amino]methyl]-4-hydroxyphenyl]methyl]phenol.
| Compound Name | 2-[[ethyl(methyl)amino]methyl]-4-[[3-[[ethyl(methyl)amino]methyl]-4-hydroxyphenyl]methyl]phenol |
|---|---|
| PubChem CID | 163931349 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2-[[ethyl(methyl)amino]methyl]-4-[[3-[[ethyl(methyl)amino]methyl]-4-hydroxyphenyl]methyl]phenol |
| SMILES | CCN(C)Cc1cc(Cc2ccc(O)c(CN(C)CC)c2)ccc1O |
| InChI | InChI=1S/C21H30N2O2/c1-5-22(3)14-18-12-16(7-9-20(18)24)11-17-8-10-21(25)19(13-17)15-23(4)6-2/h7-10,12-13,24-25H,5-6,11,14-15H2,1-4H3 |
| InChIKey | KIZLDPXSMNZAAE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|