C28H44BrO9P3 — CID 139552653
1-[[3-(bromomethyl)-5-(2-diethoxyphosphorylethyl)phenyl]methyl]-3,5-bis(2-dimethoxyphosphorylethyl)benzene (PubChem CID 139552653) has the molecular formula C28H44BrO9P3 and a molecular weight of 697.48 g/mol. Its IUPAC name is 1-[[3-(bromomethyl)-5-(2-diethoxyphosphorylethyl)phenyl]methyl]-3,5-bis(2-dimethoxyphosphorylethyl)benzene.
| Compound Name | 1-[[3-(bromomethyl)-5-(2-diethoxyphosphorylethyl)phenyl]methyl]-3,5-bis(2-dimethoxyphosphorylethyl)benzene |
|---|---|
| PubChem CID | 139552653 |
| Molecular Formula | C28H44BrO9P3 |
| Molecular Weight | 697.48 g/mol |
| Exact Mass | 696.14 |
| IUPAC Name | 1-[[3-(bromomethyl)-5-(2-diethoxyphosphorylethyl)phenyl]methyl]-3,5-bis(2-dimethoxyphosphorylethyl)benzene |
| SMILES | CCOP(=O)(CCc1cc(CBr)cc(Cc2cc(CCP(=O)(OC)OC)cc(CCP(=O)(OC)OC)c2)c1)OCC |
| InChI | InChI=1S/C28H44BrO9P3/c1-7-37-41(32,38-8-2)14-11-25-18-27(21-28(19-25)22-29)20-26-16-23(9-12-39(30,33-3)34-4)15-24(17-26)10-13-40(31,35-5)36-6/h15-19,21H,7-14,20,22H2,1-6H3 |
| InChIKey | DBJKMHBVRMZUFN-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.48 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|