C18H32NO10P3 — CID 102245240
N-(diethoxyphosphorylmethyl)-3,5-bis(dimethoxyphosphorylmethyl)benzamide (PubChem CID 102245240) has the molecular formula C18H32NO10P3 and a molecular weight of 515.37 g/mol. Its IUPAC name is N-(diethoxyphosphorylmethyl)-3,5-bis(dimethoxyphosphorylmethyl)benzamide.
| Compound Name | N-(diethoxyphosphorylmethyl)-3,5-bis(dimethoxyphosphorylmethyl)benzamide |
|---|---|
| PubChem CID | 102245240 |
| Molecular Formula | C18H32NO10P3 |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | N-(diethoxyphosphorylmethyl)-3,5-bis(dimethoxyphosphorylmethyl)benzamide |
| SMILES | CCOP(=O)(CNC(=O)c1cc(CP(=O)(OC)OC)cc(CP(=O)(OC)OC)c1)OCC |
| InChI | InChI=1S/C18H32NO10P3/c1-7-28-32(23,29-8-2)14-19-18(20)17-10-15(12-30(21,24-3)25-4)9-16(11-17)13-31(22,26-5)27-6/h9-11H,7-8,12-14H2,1-6H3,(H,19,20) |
| InChIKey | NJGWBKFMQURQOU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|