C29H43O11P3 — CID 139533605
methyl 3-[[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]methyl]-5-[(E)-2-diethoxyphosphorylethenyl]benzoate (PubChem CID 139533605) has the molecular formula C29H43O11P3 and a molecular weight of 660.57 g/mol. Its IUPAC name is methyl 3-[[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]methyl]-5-[(E)-2-diethoxyphosphorylethenyl]benzoate.
| Compound Name | methyl 3-[[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]methyl]-5-[(E)-2-diethoxyphosphorylethenyl]benzoate |
|---|---|
| PubChem CID | 139533605 |
| Molecular Formula | C29H43O11P3 |
| Molecular Weight | 660.57 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | methyl 3-[[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]methyl]-5-[(E)-2-diethoxyphosphorylethenyl]benzoate |
| SMILES | CCOP(=O)(/C=C/c1cc(Cc2cc(CCP(=O)(OC)OC)cc(CCP(=O)(OC)OC)c2)cc(C(=O)OC)c1)OCC |
| InChI | InChI=1S/C29H43O11P3/c1-8-39-43(33,40-9-2)15-12-25-19-27(22-28(21-25)29(30)34-3)20-26-17-23(10-13-41(31,35-4)36-5)16-24(18-26)11-14-42(32,37-6)38-7/h12,15-19,21-22H,8-11,13-14,20H2,1-7H3/b15-12+ |
| InChIKey | MKPSJQUWONWMCA-NTCAYCPXSA-N |
| XLogP | 7.36 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.57 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|