C13H21O5P — CID 87176074
butan-2-yloxy-[[4-(2-hydroxyethoxy)phenyl]methyl]phosphinic acid (PubChem CID 87176074) has the molecular formula C13H21O5P and a molecular weight of 288.28 g/mol. Its IUPAC name is butan-2-yloxy-[[4-(2-hydroxyethoxy)phenyl]methyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[[4-(2-hydroxyethoxy)phenyl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 87176074 |
| Molecular Formula | C13H21O5P |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | butan-2-yloxy-[[4-(2-hydroxyethoxy)phenyl]methyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)Cc1ccc(OCCO)cc1 |
| InChI | InChI=1S/C13H21O5P/c1-3-11(2)18-19(15,16)10-12-4-6-13(7-5-12)17-9-8-14/h4-7,11,14H,3,8-10H2,1-2H3,(H,15,16) |
| InChIKey | FXIPHFQDTQSFLQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|