C17H21O4PS — CID 87175755
butan-2-yloxy-[[4-(4-hydroxyphenyl)sulfanylphenyl]methyl]phosphinic acid (PubChem CID 87175755) has the molecular formula C17H21O4PS and a molecular weight of 352.39 g/mol. Its IUPAC name is butan-2-yloxy-[[4-(4-hydroxyphenyl)sulfanylphenyl]methyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[[4-(4-hydroxyphenyl)sulfanylphenyl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 87175755 |
| Molecular Formula | C17H21O4PS |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | butan-2-yloxy-[[4-(4-hydroxyphenyl)sulfanylphenyl]methyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)Cc1ccc(Sc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H21O4PS/c1-3-13(2)21-22(19,20)12-14-4-8-16(9-5-14)23-17-10-6-15(18)7-11-17/h4-11,13,18H,3,12H2,1-2H3,(H,19,20) |
| InChIKey | LOTHNLGKRBIITL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|