C16H19O5PS — CID 66841767
[4-[4-(1-methoxyethoxy)phenyl]sulfanylphenyl]methylphosphonic acid (PubChem CID 66841767) has the molecular formula C16H19O5PS and a molecular weight of 354.36 g/mol. Its IUPAC name is [4-[4-(1-methoxyethoxy)phenyl]sulfanylphenyl]methylphosphonic acid.
| Compound Name | [4-[4-(1-methoxyethoxy)phenyl]sulfanylphenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 66841767 |
| Molecular Formula | C16H19O5PS |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [4-[4-(1-methoxyethoxy)phenyl]sulfanylphenyl]methylphosphonic acid |
| SMILES | COC(C)Oc1ccc(Sc2ccc(CP(=O)(O)O)cc2)cc1 |
| InChI | InChI=1S/C16H19O5PS/c1-12(20-2)21-14-5-9-16(10-6-14)23-15-7-3-13(4-8-15)11-22(17,18)19/h3-10,12H,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | RWAZOSHHXYMHNT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|