C16H21O3P — CID 152677811
naphthalen-2-ylmethyl(pentan-2-yloxy)phosphinic acid (PubChem CID 152677811) has the molecular formula C16H21O3P and a molecular weight of 292.31 g/mol. Its IUPAC name is naphthalen-2-ylmethyl(pentan-2-yloxy)phosphinic acid.
| Compound Name | naphthalen-2-ylmethyl(pentan-2-yloxy)phosphinic acid |
|---|---|
| PubChem CID | 152677811 |
| Molecular Formula | C16H21O3P |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | naphthalen-2-ylmethyl(pentan-2-yloxy)phosphinic acid |
| SMILES | CCCC(C)OP(=O)(O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H21O3P/c1-3-6-13(2)19-20(17,18)12-14-9-10-15-7-4-5-8-16(15)11-14/h4-5,7-11,13H,3,6,12H2,1-2H3,(H,17,18) |
| InChIKey | ZMWRTYZNMDVHCV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|