C15H19O4P — CID 87175695
butan-2-yloxy-[(2-hydroxynaphthalen-1-yl)methyl]phosphinic acid (PubChem CID 87175695) has the molecular formula C15H19O4P and a molecular weight of 294.29 g/mol. Its IUPAC name is butan-2-yloxy-[(2-hydroxynaphthalen-1-yl)methyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[(2-hydroxynaphthalen-1-yl)methyl]phosphinic acid |
|---|---|
| PubChem CID | 87175695 |
| Molecular Formula | C15H19O4P |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | butan-2-yloxy-[(2-hydroxynaphthalen-1-yl)methyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C15H19O4P/c1-3-11(2)19-20(17,18)10-14-13-7-5-4-6-12(13)8-9-15(14)16/h4-9,11,16H,3,10H2,1-2H3,(H,17,18) |
| InChIKey | JCJOICLKYBNYKB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|