C25H25N2O4P — CID 87338125
butan-2-yloxy-[[(8-naphthalen-1-ylquinoline-2-carbonyl)amino]methyl]phosphinic acid (PubChem CID 87338125) has the molecular formula C25H25N2O4P and a molecular weight of 448.46 g/mol. Its IUPAC name is butan-2-yloxy-[[(8-naphthalen-1-ylquinoline-2-carbonyl)amino]methyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[[(8-naphthalen-1-ylquinoline-2-carbonyl)amino]methyl]phosphinic acid |
|---|---|
| PubChem CID | 87338125 |
| Molecular Formula | C25H25N2O4P |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | butan-2-yloxy-[[(8-naphthalen-1-ylquinoline-2-carbonyl)amino]methyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)CNC(=O)c1ccc2cccc(-c3cccc4ccccc34)c2n1 |
| InChI | InChI=1S/C25H25N2O4P/c1-3-17(2)31-32(29,30)16-26-25(28)23-15-14-19-10-7-13-22(24(19)27-23)21-12-6-9-18-8-4-5-11-20(18)21/h4-15,17H,3,16H2,1-2H3,(H,26,28)(H,29,30) |
| InChIKey | XBCSWKLDKAONTQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|