C16H23O3PS — CID 87146796
butan-2-yloxy-[(3-propan-2-yl-1-benzothiophen-2-yl)methyl]phosphinic acid (PubChem CID 87146796) has the molecular formula C16H23O3PS and a molecular weight of 326.40 g/mol. Its IUPAC name is butan-2-yloxy-[(3-propan-2-yl-1-benzothiophen-2-yl)methyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[(3-propan-2-yl-1-benzothiophen-2-yl)methyl]phosphinic acid |
|---|---|
| PubChem CID | 87146796 |
| Molecular Formula | C16H23O3PS |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | butan-2-yloxy-[(3-propan-2-yl-1-benzothiophen-2-yl)methyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)Cc1sc2ccccc2c1C(C)C |
| InChI | InChI=1S/C16H23O3PS/c1-5-12(4)19-20(17,18)10-15-16(11(2)3)13-8-6-7-9-14(13)21-15/h6-9,11-12H,5,10H2,1-4H3,(H,17,18) |
| InChIKey | LGUUYYQOWJRLLG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|