C18H20O4S — CID 14975071
diethyl 2-(2-prop-2-enyl-1-benzothiophen-3-yl)propanedioate (PubChem CID 14975071) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is diethyl 2-(2-prop-2-enyl-1-benzothiophen-3-yl)propanedioate.
| Compound Name | diethyl 2-(2-prop-2-enyl-1-benzothiophen-3-yl)propanedioate |
|---|---|
| PubChem CID | 14975071 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | diethyl 2-(2-prop-2-enyl-1-benzothiophen-3-yl)propanedioate |
| SMILES | C=CCc1sc2ccccc2c1C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H20O4S/c1-4-9-14-15(12-10-7-8-11-13(12)23-14)16(17(19)21-5-2)18(20)22-6-3/h4,7-8,10-11,16H,1,5-6,9H2,2-3H3 |
| InChIKey | YDUQZTZVUZUSNA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|