C12H10O2S — CID 82364874
3-prop-2-enyl-1-benzothiophene-2-carboxylic acid (PubChem CID 82364874) has the molecular formula C12H10O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-prop-2-enyl-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-prop-2-enyl-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 82364874 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 3-prop-2-enyl-1-benzothiophene-2-carboxylic acid |
| SMILES | C=CCc1c(C(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C12H10O2S/c1-2-5-9-8-6-3-4-7-10(8)15-11(9)12(13)14/h2-4,6-7H,1,5H2,(H,13,14) |
| InChIKey | DGHOYBAYBJFEQW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|