C13H9F3O2S — CID 84750982
3-prop-2-enyl-6-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 84750982) has the molecular formula C13H9F3O2S and a molecular weight of 286.27 g/mol. Its IUPAC name is 3-prop-2-enyl-6-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-prop-2-enyl-6-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 84750982 |
| Molecular Formula | C13H9F3O2S |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-prop-2-enyl-6-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | C=CCc1c(C(=O)O)sc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C13H9F3O2S/c1-2-3-9-8-5-4-7(13(14,15)16)6-10(8)19-11(9)12(17)18/h2,4-6H,1,3H2,(H,17,18) |
| InChIKey | OJZLHYYJDYLRDV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|