C12H9F3OS — CID 117196113
1-[6-(trifluoromethyl)-1-benzothiophen-3-yl]propan-2-one (PubChem CID 117196113) has the molecular formula C12H9F3OS and a molecular weight of 258.26 g/mol. Its IUPAC name is 1-[6-(trifluoromethyl)-1-benzothiophen-3-yl]propan-2-one.
| Compound Name | 1-[6-(trifluoromethyl)-1-benzothiophen-3-yl]propan-2-one |
|---|---|
| PubChem CID | 117196113 |
| Molecular Formula | C12H9F3OS |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 1-[6-(trifluoromethyl)-1-benzothiophen-3-yl]propan-2-one |
| SMILES | CC(=O)Cc1csc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C12H9F3OS/c1-7(16)4-8-6-17-11-5-9(12(13,14)15)2-3-10(8)11/h2-3,5-6H,4H2,1H3 |
| InChIKey | LVQYNQORRBGTPD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |