C22H23ClF3NO2S — CID 139993877
4-ethoxy-N-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]butyl]benzamide;hydrochloride (PubChem CID 139993877) has the molecular formula C22H23ClF3NO2S and a molecular weight of 457.95 g/mol. Its IUPAC name is 4-ethoxy-N-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]butyl]benzamide;hydrochloride.
| Compound Name | 4-ethoxy-N-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]butyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 139993877 |
| Molecular Formula | C22H23ClF3NO2S |
| Molecular Weight | 457.95 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 4-ethoxy-N-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]butyl]benzamide;hydrochloride |
| SMILES | CCOc1ccc(C(=O)NCCCCc2csc3cc(C(F)(F)F)ccc23)cc1.Cl |
| InChI | InChI=1S/C22H22F3NO2S.ClH/c1-2-28-18-9-6-15(7-10-18)21(27)26-12-4-3-5-16-14-29-20-13-17(22(23,24)25)8-11-19(16)20;/h6-11,13-14H,2-5,12H2,1H3,(H,26,27);1H |
| InChIKey | PIOFDULMCRTJNK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.95 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|