C13H11F3O2S — CID 117120692
2-methyl-3-[5-(trifluoromethyl)-1-benzothiophen-3-yl]propanoic acid (PubChem CID 117120692) has the molecular formula C13H11F3O2S and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-methyl-3-[5-(trifluoromethyl)-1-benzothiophen-3-yl]propanoic acid.
| Compound Name | 2-methyl-3-[5-(trifluoromethyl)-1-benzothiophen-3-yl]propanoic acid |
|---|---|
| PubChem CID | 117120692 |
| Molecular Formula | C13H11F3O2S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-methyl-3-[5-(trifluoromethyl)-1-benzothiophen-3-yl]propanoic acid |
| SMILES | CC(Cc1csc2ccc(C(F)(F)F)cc12)C(=O)O |
| InChI | InChI=1S/C13H11F3O2S/c1-7(12(17)18)4-8-6-19-11-3-2-9(5-10(8)11)13(14,15)16/h2-3,5-7H,4H2,1H3,(H,17,18) |
| InChIKey | UZHQMUBGYPBYDK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |