C11H10BrF3O — CID 131281956
1-[2-(bromomethyl)-5-(trifluoromethyl)phenyl]propan-2-one (PubChem CID 131281956) has the molecular formula C11H10BrF3O and a molecular weight of 295.10 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-5-(trifluoromethyl)phenyl]propan-2-one.
| Compound Name | 1-[2-(bromomethyl)-5-(trifluoromethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 131281956 |
| Molecular Formula | C11H10BrF3O |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 1-[2-(bromomethyl)-5-(trifluoromethyl)phenyl]propan-2-one |
| SMILES | CC(=O)Cc1cc(C(F)(F)F)ccc1CBr |
| InChI | InChI=1S/C11H10BrF3O/c1-7(16)4-9-5-10(11(13,14)15)3-2-8(9)6-12/h2-3,5H,4,6H2,1H3 |
| InChIKey | FHGKWUCSHGNIOV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|