C36H31F3O3S — CID 66883290
3-[5-methyl-2,4-bis(phenylmethoxy)phenyl]-1-[3-propyl-6-(trifluoromethyl)-1-benzothiophen-2-yl]prop-2-en-1-one (PubChem CID 66883290) has the molecular formula C36H31F3O3S and a molecular weight of 600.70 g/mol. Its IUPAC name is 3-[5-methyl-2,4-bis(phenylmethoxy)phenyl]-1-[3-propyl-6-(trifluoromethyl)-1-benzothiophen-2-yl]prop-2-en-1-one.
| Compound Name | 3-[5-methyl-2,4-bis(phenylmethoxy)phenyl]-1-[3-propyl-6-(trifluoromethyl)-1-benzothiophen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 66883290 |
| Molecular Formula | C36H31F3O3S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | 3-[5-methyl-2,4-bis(phenylmethoxy)phenyl]-1-[3-propyl-6-(trifluoromethyl)-1-benzothiophen-2-yl]prop-2-en-1-one |
| SMILES | CCCc1c(C(=O)C=Cc2cc(C)c(OCc3ccccc3)cc2OCc2ccccc2)sc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C36H31F3O3S/c1-3-10-30-29-17-16-28(36(37,38)39)20-34(29)43-35(30)31(40)18-15-27-19-24(2)32(41-22-25-11-6-4-7-12-25)21-33(27)42-23-26-13-8-5-9-14-26/h4-9,11-21H,3,10,22-23H2,1-2H3 |
| InChIKey | YPKWBZYYGJOLAY-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|