C15H13ClF3NOS — CID 71897463
3-chloro-N-(1-cyclopropylethyl)-6-(trifluoromethyl)-1-benzothiophene-2-carboxamide (PubChem CID 71897463) has the molecular formula C15H13ClF3NOS and a molecular weight of 347.79 g/mol. Its IUPAC name is 3-chloro-N-(1-cyclopropylethyl)-6-(trifluoromethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(1-cyclopropylethyl)-6-(trifluoromethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 71897463 |
| Molecular Formula | C15H13ClF3NOS |
| Molecular Weight | 347.79 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 3-chloro-N-(1-cyclopropylethyl)-6-(trifluoromethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1sc2cc(C(F)(F)F)ccc2c1Cl)C1CC1 |
| InChI | InChI=1S/C15H13ClF3NOS/c1-7(8-2-3-8)20-14(21)13-12(16)10-5-4-9(15(17,18)19)6-11(10)22-13/h4-8H,2-3H2,1H3,(H,20,21) |
| InChIKey | RDIBNAZYKCIBDE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |