C15H25O7P — CID 87176033
[2,5-bis(2-hydroxyethoxy)phenyl]methyl-butan-2-yloxyphosphinic acid (PubChem CID 87176033) has the molecular formula C15H25O7P and a molecular weight of 348.33 g/mol. Its IUPAC name is [2,5-bis(2-hydroxyethoxy)phenyl]methyl-butan-2-yloxyphosphinic acid.
| Compound Name | [2,5-bis(2-hydroxyethoxy)phenyl]methyl-butan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 87176033 |
| Molecular Formula | C15H25O7P |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [2,5-bis(2-hydroxyethoxy)phenyl]methyl-butan-2-yloxyphosphinic acid |
| SMILES | CCC(C)OP(=O)(O)Cc1cc(OCCO)ccc1OCCO |
| InChI | InChI=1S/C15H25O7P/c1-3-12(2)22-23(18,19)11-13-10-14(20-8-6-16)4-5-15(13)21-9-7-17/h4-5,10,12,16-17H,3,6-9,11H2,1-2H3,(H,18,19) |
| InChIKey | SKZXNWGWGCXITK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|