C26H36O4 — CID 18618779
2-[2-ethyl-4-[1-[3-ethyl-4-(2-hydroxyethoxy)phenyl]cyclohexyl]phenoxy]ethanol (PubChem CID 18618779) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-[2-ethyl-4-[1-[3-ethyl-4-(2-hydroxyethoxy)phenyl]cyclohexyl]phenoxy]ethanol.
| Compound Name | 2-[2-ethyl-4-[1-[3-ethyl-4-(2-hydroxyethoxy)phenyl]cyclohexyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 18618779 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[2-ethyl-4-[1-[3-ethyl-4-(2-hydroxyethoxy)phenyl]cyclohexyl]phenoxy]ethanol |
| SMILES | CCc1cc(C2(c3ccc(OCCO)c(CC)c3)CCCCC2)ccc1OCCO |
| InChI | InChI=1S/C26H36O4/c1-3-20-18-22(8-10-24(20)29-16-14-27)26(12-6-5-7-13-26)23-9-11-25(30-17-15-28)21(4-2)19-23/h8-11,18-19,27-28H,3-7,12-17H2,1-2H3 |
| InChIKey | IHNKXPZELSPNDI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |